C22H24O2 — CID 11001746
(1S,2S,6S,7R)-4-[(1S,2R)-2-phenylcyclohexyl]oxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 11001746) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is (1S,2S,6S,7R)-4-[(1S,2R)-2-phenylcyclohexyl]oxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2S,6S,7R)-4-[(1S,2R)-2-phenylcyclohexyl]oxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 11001746 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (1S,2S,6S,7R)-4-[(1S,2R)-2-phenylcyclohexyl]oxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C(O[C@H]2CCCC[C@@H]2c2ccccc2)=C[C@H]2[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C22H24O2/c23-22-20(13-18-15-10-11-16(12-15)21(18)22)24-19-9-5-4-8-17(19)14-6-2-1-3-7-14/h1-3,6-7,10-11,13,15-19,21H,4-5,8-9,12H2/t15-,16+,17+,18+,19-,21-/m0/s1 |
| InChIKey | HRMNHZLMLGLFKB-DLHQSYQFSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|