C36H45BO3 — CID 125124690
[(1R,2R)-2-phenylcyclohexyl] [(1S,2R)-2-phenylcyclohexyl] [(1S,2S)-2-phenylcyclohexyl] borate (PubChem CID 125124690) has the molecular formula C36H45BO3 and a molecular weight of 536.57 g/mol. Its IUPAC name is [(1R,2R)-2-phenylcyclohexyl] [(1S,2R)-2-phenylcyclohexyl] [(1S,2S)-2-phenylcyclohexyl] borate.
| Compound Name | [(1R,2R)-2-phenylcyclohexyl] [(1S,2R)-2-phenylcyclohexyl] [(1S,2S)-2-phenylcyclohexyl] borate |
|---|---|
| PubChem CID | 125124690 |
| Molecular Formula | C36H45BO3 |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.35 |
| IUPAC Name | [(1R,2R)-2-phenylcyclohexyl] [(1S,2R)-2-phenylcyclohexyl] [(1S,2S)-2-phenylcyclohexyl] borate |
| SMILES | c1ccc([C@H]2CCCC[C@@H]2OB(O[C@H]2CCCC[C@H]2c2ccccc2)O[C@@H]2CCCC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C36H45BO3/c1-4-16-28(17-5-1)31-22-10-13-25-34(31)38-37(39-35-26-14-11-23-32(35)29-18-6-2-7-19-29)40-36-27-15-12-24-33(36)30-20-8-3-9-21-30/h1-9,16-21,31-36H,10-15,22-27H2/t31-,32-,33+,34-,35+,36+/m1/s1 |
| InChIKey | GHMDTEDTNDZHTB-ITTUHDEKSA-N |
| XLogP | 9.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|