C21H28OS2 — CID 11810535
(1R,2R,6S,7S)-4-[[(1R,2R,4R)-7,7-dimethyl-1-(methylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl]sulfanyl]tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 11810535) has the molecular formula C21H28OS2 and a molecular weight of 360.59 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4-[[(1R,2R,4R)-7,7-dimethyl-1-(methylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl]sulfanyl]tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1R,2R,6S,7S)-4-[[(1R,2R,4R)-7,7-dimethyl-1-(methylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl]sulfanyl]tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 11810535 |
| Molecular Formula | C21H28OS2 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (1R,2R,6S,7S)-4-[[(1R,2R,4R)-7,7-dimethyl-1-(methylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl]sulfanyl]tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | CSC[C@]12CC[C@H](C[C@H]1SC1=C[C@@H]3[C@H](C1=O)[C@H]1C=C[C@@H]3C1)C2(C)C |
| InChI | InChI=1S/C21H28OS2/c1-20(2)14-6-7-21(20,11-23-3)17(9-14)24-16-10-15-12-4-5-13(8-12)18(15)19(16)22/h4-5,10,12-15,17-18H,6-9,11H2,1-3H3/t12-,13+,14-,15+,17-,18-,21-/m1/s1 |
| InChIKey | ZMGHUXWVHBWWIW-IXVCFHSUSA-N |
| XLogP | 5.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|