C17H32O2S2 — CID 11013025
(1R,2R,4R)-2-(2,2-diethoxyethylsulfanyl)-7,7-dimethyl-1-(methylsulfanylmethyl)bicyclo[2.2.1]heptane (PubChem CID 11013025) has the molecular formula C17H32O2S2 and a molecular weight of 332.58 g/mol. Its IUPAC name is (1R,2R,4R)-2-(2,2-diethoxyethylsulfanyl)-7,7-dimethyl-1-(methylsulfanylmethyl)bicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,4R)-2-(2,2-diethoxyethylsulfanyl)-7,7-dimethyl-1-(methylsulfanylmethyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 11013025 |
| Molecular Formula | C17H32O2S2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (1R,2R,4R)-2-(2,2-diethoxyethylsulfanyl)-7,7-dimethyl-1-(methylsulfanylmethyl)bicyclo[2.2.1]heptane |
| SMILES | CCOC(CS[C@@H]1C[C@H]2CC[C@]1(CSC)C2(C)C)OCC |
| InChI | InChI=1S/C17H32O2S2/c1-6-18-15(19-7-2)11-21-14-10-13-8-9-17(14,12-20-5)16(13,3)4/h13-15H,6-12H2,1-5H3/t13-,14-,17-/m1/s1 |
| InChIKey | BSFLTNREVXFGLU-CKEIUWERSA-N |
| XLogP | 4.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|