C10H16Cl2 — CID 171803242
(1S,2R,4R)-2-chloro-1-(chloromethyl)-7,7-dimethylbicyclo[2.2.1]heptane (PubChem CID 171803242) has the molecular formula C10H16Cl2 and a molecular weight of 207.14 g/mol. Its IUPAC name is (1S,2R,4R)-2-chloro-1-(chloromethyl)-7,7-dimethylbicyclo[2.2.1]heptane.
| Compound Name | (1S,2R,4R)-2-chloro-1-(chloromethyl)-7,7-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 171803242 |
| Molecular Formula | C10H16Cl2 |
| Molecular Weight | 207.14 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | (1S,2R,4R)-2-chloro-1-(chloromethyl)-7,7-dimethylbicyclo[2.2.1]heptane |
| SMILES | CC1(C)[C@@H]2CC[C@]1(CCl)[C@H](Cl)C2 |
| InChI | InChI=1S/C10H16Cl2/c1-9(2)7-3-4-10(9,6-11)8(12)5-7/h7-8H,3-6H2,1-2H3/t7-,8-,10+/m1/s1 |
| InChIKey | PMGLNQZYQAIVAZ-MRTMQBJTSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.14 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|