About 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile
3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile (PubChem CID 13039127) has the molecular formula C12H18ClN
and a molecular weight of 211.74 g/mol. Its IUPAC name is 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile.
Molecular Properties
| Compound Name | 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile |
| PubChem CID | 13039127 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile |
| SMILES | CC1(C)C2CCC1(CCC#N)C(Cl)C2 |
| InChI | InChI=1S/C12H18ClN/c1-11(2)9-4-6-12(11,5-3-7-14)10(13)8-9/h9-10H,3-6,8H2,1-2H3 |
| InChIKey | LGBYXCUGHLIUQJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile?
The IUPAC name of 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile (CID 13039127) is 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile.
What is the SMILES notation for 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile?
The canonical SMILES for 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile is CC1(C)C2CCC1(CCC#N)C(Cl)C2.
What is the InChIKey of 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile?
The InChIKey is LGBYXCUGHLIUQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN/c1-11(2)9-4-6-12(11,5-3-7-14)10(13)8-9/h9-10H,3-6,8H2,1-2H3.
What are the key properties of 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile?
3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile has a molecular weight of 211.74 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)propanenitrile is sourced from PubChem (CID 13039127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).