C11H21Cl2N — CID 70620543
2-[(1R,2R,4S)-2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]ethanamine;hydrochloride (PubChem CID 70620543) has the molecular formula C11H21Cl2N and a molecular weight of 238.20 g/mol. Its IUPAC name is 2-[(1R,2R,4S)-2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]ethanamine;hydrochloride.
| Compound Name | 2-[(1R,2R,4S)-2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 70620543 |
| Molecular Formula | C11H21Cl2N |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-[(1R,2R,4S)-2-chloro-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]ethanamine;hydrochloride |
| SMILES | CC1(C)[C@H]2CC[C@]1(CCN)[C@H](Cl)C2.Cl |
| InChI | InChI=1S/C11H20ClN.ClH/c1-10(2)8-3-4-11(10,5-6-13)9(12)7-8;/h8-9H,3-7,13H2,1-2H3;1H/t8-,9+,11-;/m0./s1 |
| InChIKey | SMVYLFJSJNRYJH-GSTSRXQZSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|