C24H40ClNO4S — CID 51006496
[(1R,2R,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-chloroacetate (PubChem CID 51006496) has the molecular formula C24H40ClNO4S and a molecular weight of 474.11 g/mol. Its IUPAC name is [(1R,2R,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-chloroacetate.
| Compound Name | [(1R,2R,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-chloroacetate |
|---|---|
| PubChem CID | 51006496 |
| Molecular Formula | C24H40ClNO4S |
| Molecular Weight | 474.11 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | [(1R,2R,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-chloroacetate |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)[C@H](OC(=O)CCl)C2 |
| InChI | InChI=1S/C24H40ClNO4S/c1-23(2)18-13-14-24(23,21(15-18)30-22(27)16-25)17-31(28,29)26(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h18-21H,3-17H2,1-2H3/t18-,21+,24-/m0/s1 |
| InChIKey | SJOHDHIPPUYCTN-VNZMSGEBSA-N |
| XLogP | 5.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.11 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|