C28H47NO4S — CID 10413391
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (E)-4-methylpent-2-enoate (PubChem CID 10413391) has the molecular formula C28H47NO4S and a molecular weight of 493.75 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (E)-4-methylpent-2-enoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (E)-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 10413391 |
| Molecular Formula | C28H47NO4S |
| Molecular Weight | 493.75 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (E)-4-methylpent-2-enoate |
| SMILES | CC(C)/C=C/C(=O)O[C@@H]1C[C@H]2CC[C@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)C2(C)C |
| InChI | InChI=1S/C28H47NO4S/c1-21(2)15-16-26(30)33-25-19-22-17-18-28(25,27(22,3)4)20-34(31,32)29(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h15-16,21-25H,5-14,17-20H2,1-4H3/b16-15+/t22-,25-,28-/m1/s1 |
| InChIKey | PUJFAYCCZFXPER-PFORBABDSA-N |
| XLogP | 6.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|