C39H60N2O5S — CID 11563755
[(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (4S,5S)-5-tert-butyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxylate (PubChem CID 11563755) has the molecular formula C39H60N2O5S and a molecular weight of 668.99 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (4S,5S)-5-tert-butyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxylate.
| Compound Name | [(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (4S,5S)-5-tert-butyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 11563755 |
| Molecular Formula | C39H60N2O5S |
| Molecular Weight | 668.99 g/mol |
| Exact Mass | 668.42 |
| IUPAC Name | [(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] (4S,5S)-5-tert-butyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carboxylate |
| SMILES | Cc1cc(C)c(C2=NO[C@H](C(C)(C)C)[C@H]2C(=O)O[C@H]2C[C@@H]3CC[C@@]2(CS(=O)(=O)N(C2CCCCC2)C2CCCCC2)C3(C)C)c(C)c1 |
| InChI | InChI=1S/C39H60N2O5S/c1-25-21-26(2)32(27(3)22-25)34-33(35(46-40-34)37(4,5)6)36(42)45-31-23-28-19-20-39(31,38(28,7)8)24-47(43,44)41(29-15-11-9-12-16-29)30-17-13-10-14-18-30/h21-22,28-31,33,35H,9-20,23-24H2,1-8H3/t28-,31-,33-,35-,39-/m0/s1 |
| InChIKey | XARQFKKJVISQOU-VRSMJYKBSA-N |
| XLogP | 8.41 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.99 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |