C35H50N2O5S — CID 11520058
[(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-(2,4,6-trimethylphenyl)-1,2-oxazole-4-carboxylate (PubChem CID 11520058) has the molecular formula C35H50N2O5S and a molecular weight of 610.86 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-(2,4,6-trimethylphenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | [(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-(2,4,6-trimethylphenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 11520058 |
| Molecular Formula | C35H50N2O5S |
| Molecular Weight | 610.86 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | [(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-(2,4,6-trimethylphenyl)-1,2-oxazole-4-carboxylate |
| SMILES | Cc1cc(C)c(-c2nocc2C(=O)O[C@H]2C[C@@H]3CC[C@@]2(CS(=O)(=O)N(C2CCCCC2)C2CCCCC2)C3(C)C)c(C)c1 |
| InChI | InChI=1S/C35H50N2O5S/c1-23-18-24(2)31(25(3)19-23)32-29(21-41-36-32)33(38)42-30-20-26-16-17-35(30,34(26,4)5)22-43(39,40)37(27-12-8-6-9-13-27)28-14-10-7-11-15-28/h18-19,21,26-28,30H,6-17,20,22H2,1-5H3/t26-,30-,35-/m0/s1 |
| InChIKey | AGAWVRRMCYLILY-LRVQLPGGSA-N |
| XLogP | 7.92 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.86 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |