C36H52N2O5S — CID 11520132
[(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-methyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole-4-carboxylate (PubChem CID 11520132) has the molecular formula C36H52N2O5S and a molecular weight of 624.89 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-methyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | [(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-methyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 11520132 |
| Molecular Formula | C36H52N2O5S |
| Molecular Weight | 624.89 g/mol |
| Exact Mass | 624.36 |
| IUPAC Name | [(1R,2S,4S)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-methyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole-4-carboxylate |
| SMILES | Cc1cc(C)c(-c2noc(C)c2C(=O)O[C@H]2C[C@@H]3CC[C@@]2(CS(=O)(=O)N(C2CCCCC2)C2CCCCC2)C3(C)C)c(C)c1 |
| InChI | InChI=1S/C36H52N2O5S/c1-23-19-24(2)31(25(3)20-23)33-32(26(4)43-37-33)34(39)42-30-21-27-17-18-36(30,35(27,5)6)22-44(40,41)38(28-13-9-7-10-14-28)29-15-11-8-12-16-29/h19-20,27-30H,7-18,21-22H2,1-6H3/t27-,30-,36-/m0/s1 |
| InChIKey | GNKASFSEGKKKAR-XEUOYXRDSA-N |
| XLogP | 8.22 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.89 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |