C25H41Br2NO4S — CID 11093293
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2,3-dibromopropanoate (PubChem CID 11093293) has the molecular formula C25H41Br2NO4S and a molecular weight of 611.48 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2,3-dibromopropanoate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2,3-dibromopropanoate |
|---|---|
| PubChem CID | 11093293 |
| Molecular Formula | C25H41Br2NO4S |
| Molecular Weight | 611.48 g/mol |
| Exact Mass | 609.11 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2,3-dibromopropanoate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)[C@H](OC(=O)C(Br)CBr)C2 |
| InChI | InChI=1S/C25H41Br2NO4S/c1-24(2)18-13-14-25(24,22(15-18)32-23(29)21(27)16-26)17-33(30,31)28(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h18-22H,3-17H2,1-2H3/t18-,21?,22-,25-/m1/s1 |
| InChIKey | PIKYFRTYFAZVGK-NXQDJGKKSA-N |
| XLogP | 6.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|