C16H18N2O6 — CID 71526809
[(1R,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl] 3,4-dinitrobenzoate (PubChem CID 71526809) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is [(1R,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl] 3,4-dinitrobenzoate.
| Compound Name | [(1R,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl] 3,4-dinitrobenzoate |
|---|---|
| PubChem CID | 71526809 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | [(1R,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl] 3,4-dinitrobenzoate |
| SMILES | CC1(C)[C@H]2CC[C@@H](OC(=O)c3ccc([N+](=O)[O-])c([N+](=O)[O-])c3)[C@@H]1C2 |
| InChI | InChI=1S/C16H18N2O6/c1-16(2)10-4-6-14(11(16)8-10)24-15(19)9-3-5-12(17(20)21)13(7-9)18(22)23/h3,5,7,10-11,14H,4,6,8H2,1-2H3/t10-,11-,14+/m0/s1 |
| InChIKey | PODNLWIWBRPACN-COPLHBTASA-N |
| XLogP | 3.48 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|