About (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate
(1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate (PubChem CID 60717309) has the molecular formula C13H17N3O4
and a molecular weight of 279.30 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate |
| PubChem CID | 60717309 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate |
| SMILES | CN1CCC(OC(=O)c2ccc(N)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C13H17N3O4/c1-15-6-4-10(5-7-15)20-13(17)9-2-3-11(14)12(8-9)16(18)19/h2-3,8,10H,4-7,14H2,1H3 |
| InChIKey | XXKAWQWSPMHULU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate?
The IUPAC name of (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate (CID 60717309) is (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate.
What is the SMILES notation for (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate?
The canonical SMILES for (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate is CN1CCC(OC(=O)c2ccc(N)c([N+](=O)[O-])c2)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate?
The InChIKey is XXKAWQWSPMHULU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O4/c1-15-6-4-10(5-7-15)20-13(17)9-2-3-11(14)12(8-9)16(18)19/h2-3,8,10H,4-7,14H2,1H3.
What are the key properties of (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate?
(1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate has a molecular weight of 279.30 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) 4-amino-3-nitrobenzoate is sourced from PubChem (CID 60717309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).