About (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate
(1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate (PubChem CID 104783906) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate |
| PubChem CID | 104783906 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OC2CCN(C)CC2)ccc1N |
| InChI | InChI=1S/C14H20N2O3/c1-16-7-5-11(6-8-16)19-14(17)10-3-4-12(15)13(9-10)18-2/h3-4,9,11H,5-8,15H2,1-2H3 |
| InChIKey | AACNQHBVICMGGG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate?
The IUPAC name of (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate (CID 104783906) is (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate.
What is the SMILES notation for (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate?
The canonical SMILES for (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate is COc1cc(C(=O)OC2CCN(C)CC2)ccc1N.
What is the InChIKey of (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate?
The InChIKey is AACNQHBVICMGGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-16-7-5-11(6-8-16)19-14(17)10-3-4-12(15)13(9-10)18-2/h3-4,9,11H,5-8,15H2,1-2H3.
What are the key properties of (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate?
(1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate has a molecular weight of 264.32 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) 4-amino-3-methoxybenzoate is sourced from PubChem (CID 104783906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).