C17H25NO3 — CID 104783924
(3,3,5-trimethylcyclohexyl) 4-amino-3-methoxybenzoate (PubChem CID 104783924) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) 4-amino-3-methoxybenzoate.
| Compound Name | (3,3,5-trimethylcyclohexyl) 4-amino-3-methoxybenzoate |
|---|---|
| PubChem CID | 104783924 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) 4-amino-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OC2CC(C)CC(C)(C)C2)ccc1N |
| InChI | InChI=1S/C17H25NO3/c1-11-7-13(10-17(2,3)9-11)21-16(19)12-5-6-14(18)15(8-12)20-4/h5-6,8,11,13H,7,9-10,18H2,1-4H3 |
| InChIKey | PTQAHJCPIUJFBO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|