C15H20O4 — CID 70901489
(3,3-dimethylcyclopentyl) 4-hydroxy-3-methoxybenzoate (PubChem CID 70901489) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (3,3-dimethylcyclopentyl) 4-hydroxy-3-methoxybenzoate.
| Compound Name | (3,3-dimethylcyclopentyl) 4-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 70901489 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (3,3-dimethylcyclopentyl) 4-hydroxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OC2CCC(C)(C)C2)ccc1O |
| InChI | InChI=1S/C15H20O4/c1-15(2)7-6-11(9-15)19-14(17)10-4-5-12(16)13(8-10)18-3/h4-5,8,11,16H,6-7,9H2,1-3H3 |
| InChIKey | PNRKRXWIHNUDFH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |