C16H19NO5 — CID 162923228
(8-formyl-8-azabicyclo[3.2.1]octan-3-yl) 4-hydroxy-3-methoxybenzoate (PubChem CID 162923228) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is (8-formyl-8-azabicyclo[3.2.1]octan-3-yl) 4-hydroxy-3-methoxybenzoate.
| Compound Name | (8-formyl-8-azabicyclo[3.2.1]octan-3-yl) 4-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 162923228 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (8-formyl-8-azabicyclo[3.2.1]octan-3-yl) 4-hydroxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OC2CC3CCC(C2)N3C=O)ccc1O |
| InChI | InChI=1S/C16H19NO5/c1-21-15-6-10(2-5-14(15)19)16(20)22-13-7-11-3-4-12(8-13)17(11)9-18/h2,5-6,9,11-13,19H,3-4,7-8H2,1H3 |
| InChIKey | RRNITVUBDRMHFU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|