C23H34O6 — CID 163040266
(4,9-dihydroxy-2,5,5,9-tetramethylcycloundec-2-en-1-yl) 4-hydroxy-3-methoxybenzoate (PubChem CID 163040266) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is (4,9-dihydroxy-2,5,5,9-tetramethylcycloundec-2-en-1-yl) 4-hydroxy-3-methoxybenzoate.
| Compound Name | (4,9-dihydroxy-2,5,5,9-tetramethylcycloundec-2-en-1-yl) 4-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 163040266 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (4,9-dihydroxy-2,5,5,9-tetramethylcycloundec-2-en-1-yl) 4-hydroxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OC2CCC(C)(O)CCCC(C)(C)C(O)C=C2C)ccc1O |
| InChI | InChI=1S/C23H34O6/c1-15-13-20(25)22(2,3)10-6-11-23(4,27)12-9-18(15)29-21(26)16-7-8-17(24)19(14-16)28-5/h7-8,13-14,18,20,24-25,27H,6,9-12H2,1-5H3 |
| InChIKey | LIYLUZKKDZZNBL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|