C17H24O3 — CID 107176305
(3,4-dimethoxyphenyl)-(2,2-dimethylcyclohexyl)methanone (PubChem CID 107176305) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-(2,2-dimethylcyclohexyl)methanone.
| Compound Name | (3,4-dimethoxyphenyl)-(2,2-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 107176305 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (3,4-dimethoxyphenyl)-(2,2-dimethylcyclohexyl)methanone |
| SMILES | COc1ccc(C(=O)C2CCCCC2(C)C)cc1OC |
| InChI | InChI=1S/C17H24O3/c1-17(2)10-6-5-7-13(17)16(18)12-8-9-14(19-3)15(11-12)20-4/h8-9,11,13H,5-7,10H2,1-4H3 |
| InChIKey | YEGYEPGZERMLAM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |