C16H23NO4 — CID 27261505
N-[(1S,2S)-2-hydroxycyclohexyl]-3,4-dimethoxy-N-methylbenzamide (PubChem CID 27261505) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-3,4-dimethoxy-N-methylbenzamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-3,4-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 27261505 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-3,4-dimethoxy-N-methylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)[C@H]2CCCC[C@@H]2O)cc1OC |
| InChI | InChI=1S/C16H23NO4/c1-17(12-6-4-5-7-13(12)18)16(19)11-8-9-14(20-2)15(10-11)21-3/h8-10,12-13,18H,4-7H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | ULGDIQDWVYOSOP-STQMWFEESA-N |
| XLogP | 2.08 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |