C16H22ClNO3 — CID 95875729
3-chloro-4-ethoxy-N-[(1S,2S)-2-hydroxycyclohexyl]-N-methylbenzamide (PubChem CID 95875729) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-N-[(1S,2S)-2-hydroxycyclohexyl]-N-methylbenzamide.
| Compound Name | 3-chloro-4-ethoxy-N-[(1S,2S)-2-hydroxycyclohexyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 95875729 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-chloro-4-ethoxy-N-[(1S,2S)-2-hydroxycyclohexyl]-N-methylbenzamide |
| SMILES | CCOc1ccc(C(=O)N(C)[C@H]2CCCC[C@@H]2O)cc1Cl |
| InChI | InChI=1S/C16H22ClNO3/c1-3-21-15-9-8-11(10-12(15)17)16(20)18(2)13-6-4-5-7-14(13)19/h8-10,13-14,19H,3-7H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | SUBCAKPAXMTXBD-KBPBESRZSA-N |
| XLogP | 3.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |