C16H23NO3 — CID 95877860
N-[(1R,2S)-2-hydroxycyclohexyl]-4-methoxy-N,3-dimethylbenzamide (PubChem CID 95877860) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is N-[(1R,2S)-2-hydroxycyclohexyl]-4-methoxy-N,3-dimethylbenzamide.
| Compound Name | N-[(1R,2S)-2-hydroxycyclohexyl]-4-methoxy-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 95877860 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-[(1R,2S)-2-hydroxycyclohexyl]-4-methoxy-N,3-dimethylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)[C@@H]2CCCC[C@@H]2O)cc1C |
| InChI | InChI=1S/C16H23NO3/c1-11-10-12(8-9-15(11)20-3)16(19)17(2)13-6-4-5-7-14(13)18/h8-10,13-14,18H,4-7H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | FKQXIULJDIUUKG-KGLIPLIRSA-N |
| XLogP | 2.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |