C17H24BrNO2 — CID 107874082
(3,3,5-trimethylcyclohexyl) 3-amino-5-bromo-2-methylbenzoate (PubChem CID 107874082) has the molecular formula C17H24BrNO2 and a molecular weight of 354.29 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) 3-amino-5-bromo-2-methylbenzoate.
| Compound Name | (3,3,5-trimethylcyclohexyl) 3-amino-5-bromo-2-methylbenzoate |
|---|---|
| PubChem CID | 107874082 |
| Molecular Formula | C17H24BrNO2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) 3-amino-5-bromo-2-methylbenzoate |
| SMILES | Cc1c(N)cc(Br)cc1C(=O)OC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H24BrNO2/c1-10-5-13(9-17(3,4)8-10)21-16(20)14-6-12(18)7-15(19)11(14)2/h6-7,10,13H,5,8-9,19H2,1-4H3 |
| InChIKey | HTSGJSBCZPXRBY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|