C14H14N2O6 — CID 102426611
[(2S)-2-bicyclo[3.1.1]heptanyl] 3,5-dinitrobenzoate (PubChem CID 102426611) has the molecular formula C14H14N2O6 and a molecular weight of 306.27 g/mol. Its IUPAC name is [(2S)-2-bicyclo[3.1.1]heptanyl] 3,5-dinitrobenzoate.
| Compound Name | [(2S)-2-bicyclo[3.1.1]heptanyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 102426611 |
| Molecular Formula | C14H14N2O6 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [(2S)-2-bicyclo[3.1.1]heptanyl] 3,5-dinitrobenzoate |
| SMILES | O=C(O[C@H]1CCC2CC1C2)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H14N2O6/c17-14(22-13-2-1-8-3-9(13)4-8)10-5-11(15(18)19)7-12(6-10)16(20)21/h5-9,13H,1-4H2/t8?,9?,13-/m0/s1 |
| InChIKey | RSUWDTFIFCYDCL-RPTIHFLNSA-N |
| XLogP | 2.85 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|