C24H26N2O9 — CID 139123099
[(1S,2R,5R,7R,8R,9R,12S,13R)-2-hydroxy-6,6-dimethyl-15-oxo-14-oxapentacyclo[10.2.2.01,13.02,8.05,7]hexadecan-9-yl] 3,5-dinitrobenzoate (PubChem CID 139123099) has the molecular formula C24H26N2O9 and a molecular weight of 486.48 g/mol. Its IUPAC name is [(1S,2R,5R,7R,8R,9R,12S,13R)-2-hydroxy-6,6-dimethyl-15-oxo-14-oxapentacyclo[10.2.2.01,13.02,8.05,7]hexadecan-9-yl] 3,5-dinitrobenzoate.
| Compound Name | [(1S,2R,5R,7R,8R,9R,12S,13R)-2-hydroxy-6,6-dimethyl-15-oxo-14-oxapentacyclo[10.2.2.01,13.02,8.05,7]hexadecan-9-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 139123099 |
| Molecular Formula | C24H26N2O9 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | [(1S,2R,5R,7R,8R,9R,12S,13R)-2-hydroxy-6,6-dimethyl-15-oxo-14-oxapentacyclo[10.2.2.01,13.02,8.05,7]hexadecan-9-yl] 3,5-dinitrobenzoate |
| SMILES | CC1(C)[C@H]2[C@@H]3[C@H](OC(=O)c4cc([N+](=O)[O-])cc([N+](=O)[O-])c4)CC[C@H]4CC(=O)[C@@]5(O[C@H]45)[C@@]3(O)CC[C@H]21 |
| InChI | InChI=1S/C24H26N2O9/c1-22(2)15-5-6-23(29)19(18(15)22)16(4-3-11-9-17(27)24(23)20(11)35-24)34-21(28)12-7-13(25(30)31)10-14(8-12)26(32)33/h7-8,10-11,15-16,18-20,29H,3-6,9H2,1-2H3/t11-,15+,16+,18+,19-,20+,23+,24-/m0/s1 |
| InChIKey | AHGRJMOSTPLLAP-OXZRYQCQSA-N |
| XLogP | 2.96 |
| TPSA | 162.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|