C18H22N2O8 — CID 102317727
[(3S,4R,4aR,8aR)-4-propan-2-yl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] 3,5-dinitrobenzoate (PubChem CID 102317727) has the molecular formula C18H22N2O8 and a molecular weight of 394.38 g/mol. Its IUPAC name is [(3S,4R,4aR,8aR)-4-propan-2-yl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] 3,5-dinitrobenzoate.
| Compound Name | [(3S,4R,4aR,8aR)-4-propan-2-yl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 102317727 |
| Molecular Formula | C18H22N2O8 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [(3S,4R,4aR,8aR)-4-propan-2-yl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] 3,5-dinitrobenzoate |
| SMILES | CC(C)[C@H]1[C@H]2OCCC[C@H]2OC[C@H]1OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H22N2O8/c1-10(2)16-15(9-27-14-4-3-5-26-17(14)16)28-18(21)11-6-12(19(22)23)8-13(7-11)20(24)25/h6-8,10,14-17H,3-5,9H2,1-2H3/t14-,15-,16-,17+/m1/s1 |
| InChIKey | CLPQZGLFUCAJNQ-VQHPVUNQSA-N |
| XLogP | 2.88 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|