C24H26N2O8 — CID 87322842
[(1R,2S,4R)-2-benzoyloxy-4-tert-butylcyclohexyl] 3,5-dinitrobenzoate (PubChem CID 87322842) has the molecular formula C24H26N2O8 and a molecular weight of 470.48 g/mol. Its IUPAC name is [(1R,2S,4R)-2-benzoyloxy-4-tert-butylcyclohexyl] 3,5-dinitrobenzoate.
| Compound Name | [(1R,2S,4R)-2-benzoyloxy-4-tert-butylcyclohexyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 87322842 |
| Molecular Formula | C24H26N2O8 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | [(1R,2S,4R)-2-benzoyloxy-4-tert-butylcyclohexyl] 3,5-dinitrobenzoate |
| SMILES | CC(C)(C)[C@@H]1CC[C@@H](OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)[C@@H](OC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C24H26N2O8/c1-24(2,3)17-9-10-20(21(13-17)34-22(27)15-7-5-4-6-8-15)33-23(28)16-11-18(25(29)30)14-19(12-16)26(31)32/h4-8,11-12,14,17,20-21H,9-10,13H2,1-3H3/t17-,20-,21+/m1/s1 |
| InChIKey | AGDBRPKEWREVKD-UIFIKXQLSA-N |
| XLogP | 5.10 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|