C29H32FNO5Si — CID 67955643
[(1R,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorocyclohexyl] 3-nitrobenzoate (PubChem CID 67955643) has the molecular formula C29H32FNO5Si and a molecular weight of 521.66 g/mol. Its IUPAC name is [(1R,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorocyclohexyl] 3-nitrobenzoate.
| Compound Name | [(1R,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorocyclohexyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 67955643 |
| Molecular Formula | C29H32FNO5Si |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | [(1R,2R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-fluorocyclohexyl] 3-nitrobenzoate |
| SMILES | CC(C)(C)[Si](O[C@@H]1CC[C@@H](OC(=O)c2cccc([N+](=O)[O-])c2)[C@H](F)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32FNO5Si/c1-29(2,3)37(24-13-6-4-7-14-24,25-15-8-5-9-16-25)36-23-17-18-27(26(30)20-23)35-28(32)21-11-10-12-22(19-21)31(33)34/h4-16,19,23,26-27H,17-18,20H2,1-3H3/t23-,26-,27-/m1/s1 |
| InChIKey | DTLPZYWFZNCQNS-XSBVVTFOSA-N |
| XLogP | 5.59 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|