C23H26N2O6 — CID 101126272
[(1S,2R,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 3,5-dinitrobenzoate (PubChem CID 101126272) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is [(1S,2R,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 3,5-dinitrobenzoate.
| Compound Name | [(1S,2R,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 101126272 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [(1S,2R,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 3,5-dinitrobenzoate |
| SMILES | C[C@@H]1CC[C@H](C(C)(C)c2ccccc2)[C@@H](OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C23H26N2O6/c1-15-9-10-20(23(2,3)17-7-5-4-6-8-17)21(11-15)31-22(26)16-12-18(24(27)28)14-19(13-16)25(29)30/h4-8,12-15,20-21H,9-11H2,1-3H3/t15-,20+,21+/m1/s1 |
| InChIKey | OAJJUFDHOYOSSA-NQERJWCQSA-N |
| XLogP | 5.44 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|