C31H34ClNO4 — CID 102062883
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-(2-chloro-4-nitrophenyl)-3-phenylpropanoate (PubChem CID 102062883) has the molecular formula C31H34ClNO4 and a molecular weight of 520.07 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-(2-chloro-4-nitrophenyl)-3-phenylpropanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-(2-chloro-4-nitrophenyl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 102062883 |
| Molecular Formula | C31H34ClNO4 |
| Molecular Weight | 520.07 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-(2-chloro-4-nitrophenyl)-3-phenylpropanoate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)[C@@H](Cc2ccccc2)c2ccc([N+](=O)[O-])cc2Cl)C1 |
| InChI | InChI=1S/C31H34ClNO4/c1-21-14-17-27(31(2,3)23-12-8-5-9-13-23)29(18-21)37-30(34)26(19-22-10-6-4-7-11-22)25-16-15-24(33(35)36)20-28(25)32/h4-13,15-16,20-21,26-27,29H,14,17-19H2,1-3H3/t21-,26+,27-,29-/m1/s1 |
| InChIKey | DYMSRVHSVGHKQN-VVBXPOOASA-N |
| XLogP | 7.90 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.07 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|