C34H37F3N2O9S — CID 101337998
benzyl 3,3,3-trifluoro-2-[[[(1S,2R,5S)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxycarbonyl-(4-nitrophenyl)sulfonyloxyamino]methyl]propanoate (PubChem CID 101337998) has the molecular formula C34H37F3N2O9S and a molecular weight of 706.74 g/mol. Its IUPAC name is benzyl 3,3,3-trifluoro-2-[[[(1S,2R,5S)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxycarbonyl-(4-nitrophenyl)sulfonyloxyamino]methyl]propanoate.
| Compound Name | benzyl 3,3,3-trifluoro-2-[[[(1S,2R,5S)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxycarbonyl-(4-nitrophenyl)sulfonyloxyamino]methyl]propanoate |
|---|---|
| PubChem CID | 101337998 |
| Molecular Formula | C34H37F3N2O9S |
| Molecular Weight | 706.74 g/mol |
| Exact Mass | 706.22 |
| IUPAC Name | benzyl 3,3,3-trifluoro-2-[[[(1S,2R,5S)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxycarbonyl-(4-nitrophenyl)sulfonyloxyamino]methyl]propanoate |
| SMILES | C[C@H]1CC[C@H](C(C)(C)c2ccccc2)[C@@H](OC(=O)N(CC(C(=O)OCc2ccccc2)C(F)(F)F)OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C34H37F3N2O9S/c1-23-14-19-28(33(2,3)25-12-8-5-9-13-25)30(20-23)47-32(41)38(48-49(44,45)27-17-15-26(16-18-27)39(42)43)21-29(34(35,36)37)31(40)46-22-24-10-6-4-7-11-24/h4-13,15-18,23,28-30H,14,19-22H2,1-3H3/t23-,28-,29?,30-/m0/s1 |
| InChIKey | ISZRRSDWTZGTKK-CQOKWCHTSA-N |
| XLogP | 7.36 |
| TPSA | 142.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.74 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|