C21H20N2O9 — CID 101199082
[(1S,2S,4R)-2-(1,3-benzodioxol-5-yloxy)-4-methylcyclohexyl] 3,5-dinitrobenzoate (PubChem CID 101199082) has the molecular formula C21H20N2O9 and a molecular weight of 444.40 g/mol. Its IUPAC name is [(1S,2S,4R)-2-(1,3-benzodioxol-5-yloxy)-4-methylcyclohexyl] 3,5-dinitrobenzoate.
| Compound Name | [(1S,2S,4R)-2-(1,3-benzodioxol-5-yloxy)-4-methylcyclohexyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 101199082 |
| Molecular Formula | C21H20N2O9 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | [(1S,2S,4R)-2-(1,3-benzodioxol-5-yloxy)-4-methylcyclohexyl] 3,5-dinitrobenzoate |
| SMILES | C[C@@H]1CC[C@H](OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)[C@@H](Oc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C21H20N2O9/c1-12-2-4-18(20(6-12)31-16-3-5-17-19(10-16)30-11-29-17)32-21(24)13-7-14(22(25)26)9-15(8-13)23(27)28/h3,5,7-10,12,18,20H,2,4,6,11H2,1H3/t12-,18+,20+/m1/s1 |
| InChIKey | AVQBHAUQJRQZIX-OACQNMCBSA-N |
| XLogP | 4.02 |
| TPSA | 140.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|