C24H22N2O8 — CID 11113382
[(1R,2R)-2-(7-methoxynaphthalen-2-yl)oxycyclohexyl] 3,5-dinitrobenzoate (PubChem CID 11113382) has the molecular formula C24H22N2O8 and a molecular weight of 466.45 g/mol. Its IUPAC name is [(1R,2R)-2-(7-methoxynaphthalen-2-yl)oxycyclohexyl] 3,5-dinitrobenzoate.
| Compound Name | [(1R,2R)-2-(7-methoxynaphthalen-2-yl)oxycyclohexyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 11113382 |
| Molecular Formula | C24H22N2O8 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [(1R,2R)-2-(7-methoxynaphthalen-2-yl)oxycyclohexyl] 3,5-dinitrobenzoate |
| SMILES | COc1ccc2ccc(O[C@@H]3CCCC[C@H]3OC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc2c1 |
| InChI | InChI=1S/C24H22N2O8/c1-32-20-8-6-15-7-9-21(13-16(15)12-20)33-22-4-2-3-5-23(22)34-24(27)17-10-18(25(28)29)14-19(11-17)26(30)31/h6-14,22-23H,2-5H2,1H3/t22-,23-/m1/s1 |
| InChIKey | YFQOLMNPHSPDGY-DHIUTWEWSA-N |
| XLogP | 5.21 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|