About (2-methylcyclohexyl) 2-amino-4-nitrobenzoate
(2-methylcyclohexyl) 2-amino-4-nitrobenzoate (PubChem CID 63110730) has the molecular formula C14H18N2O4
and a molecular weight of 278.31 g/mol. Its IUPAC name is (2-methylcyclohexyl) 2-amino-4-nitrobenzoate.
Molecular Properties
| Compound Name | (2-methylcyclohexyl) 2-amino-4-nitrobenzoate |
| PubChem CID | 63110730 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2-methylcyclohexyl) 2-amino-4-nitrobenzoate |
| SMILES | CC1CCCCC1OC(=O)c1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C14H18N2O4/c1-9-4-2-3-5-13(9)20-14(17)11-7-6-10(16(18)19)8-12(11)15/h6-9,13H,2-5,15H2,1H3 |
| InChIKey | FMBDLWMYXVLXEX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methylcyclohexyl) 2-amino-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclohexyl) 2-amino-4-nitrobenzoate?
The IUPAC name of (2-methylcyclohexyl) 2-amino-4-nitrobenzoate (CID 63110730) is (2-methylcyclohexyl) 2-amino-4-nitrobenzoate.
What is the SMILES notation for (2-methylcyclohexyl) 2-amino-4-nitrobenzoate?
The canonical SMILES for (2-methylcyclohexyl) 2-amino-4-nitrobenzoate is CC1CCCCC1OC(=O)c1ccc([N+](=O)[O-])cc1N.
What is the InChIKey of (2-methylcyclohexyl) 2-amino-4-nitrobenzoate?
The InChIKey is FMBDLWMYXVLXEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O4/c1-9-4-2-3-5-13(9)20-14(17)11-7-6-10(16(18)19)8-12(11)15/h6-9,13H,2-5,15H2,1H3.
What are the key properties of (2-methylcyclohexyl) 2-amino-4-nitrobenzoate?
(2-methylcyclohexyl) 2-amino-4-nitrobenzoate has a molecular weight of 278.31 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclohexyl) 2-amino-4-nitrobenzoate is sourced from PubChem (CID 63110730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).