C16H22N2O4 — CID 100803906
ethyl 2-[[(1S,2R)-2-methylcyclohexyl]amino]-5-nitrobenzoate (PubChem CID 100803906) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is ethyl 2-[[(1S,2R)-2-methylcyclohexyl]amino]-5-nitrobenzoate.
| Compound Name | ethyl 2-[[(1S,2R)-2-methylcyclohexyl]amino]-5-nitrobenzoate |
|---|---|
| PubChem CID | 100803906 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | ethyl 2-[[(1S,2R)-2-methylcyclohexyl]amino]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])ccc1N[C@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C16H22N2O4/c1-3-22-16(19)13-10-12(18(20)21)8-9-15(13)17-14-7-5-4-6-11(14)2/h8-11,14,17H,3-7H2,1-2H3/t11-,14+/m1/s1 |
| InChIKey | ZNBMVQWKWCLKMQ-RISCZKNCSA-N |
| XLogP | 3.76 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|