C14H18N2O4 — CID 29036587
2-[[(1S,2S)-2-methylcyclohexyl]amino]-5-nitrobenzoic acid (PubChem CID 29036587) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-methylcyclohexyl]amino]-5-nitrobenzoic acid.
| Compound Name | 2-[[(1S,2S)-2-methylcyclohexyl]amino]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 29036587 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[[(1S,2S)-2-methylcyclohexyl]amino]-5-nitrobenzoic acid |
| SMILES | C[C@H]1CCCC[C@@H]1Nc1ccc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C14H18N2O4/c1-9-4-2-3-5-12(9)15-13-7-6-10(16(19)20)8-11(13)14(17)18/h6-9,12,15H,2-5H2,1H3,(H,17,18)/t9-,12-/m0/s1 |
| InChIKey | OHCHYALIUQFVJN-CABZTGNLSA-N |
| XLogP | 3.28 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|