C18H25N3O5 — CID 11914750
[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(methylamino)-5-nitrobenzoate (PubChem CID 11914750) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(methylamino)-5-nitrobenzoate.
| Compound Name | [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(methylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 11914750 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-(methylamino)-5-nitrobenzoate |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)OCC(=O)N[C@@H]1CCC[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C18H25N3O5/c1-11-5-4-6-15(12(11)2)20-17(22)10-26-18(23)14-9-13(21(24)25)7-8-16(14)19-3/h7-9,11-12,15,19H,4-6,10H2,1-3H3,(H,20,22)/t11-,12-,15-/m1/s1 |
| InChIKey | CCVWUXCGVFLJND-LALPHHSUSA-N |
| XLogP | 2.73 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|