C14H15Cl2NO4 — CID 107201348
(2-methylcyclohexyl) 2,3-dichloro-5-nitrobenzoate (PubChem CID 107201348) has the molecular formula C14H15Cl2NO4 and a molecular weight of 332.18 g/mol. Its IUPAC name is (2-methylcyclohexyl) 2,3-dichloro-5-nitrobenzoate.
| Compound Name | (2-methylcyclohexyl) 2,3-dichloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 107201348 |
| Molecular Formula | C14H15Cl2NO4 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | (2-methylcyclohexyl) 2,3-dichloro-5-nitrobenzoate |
| SMILES | CC1CCCCC1OC(=O)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C14H15Cl2NO4/c1-8-4-2-3-5-12(8)21-14(18)10-6-9(17(19)20)7-11(15)13(10)16/h6-8,12H,2-5H2,1H3 |
| InChIKey | WQRAEAAHOVILHF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|