C13H14Cl2N2O4 — CID 107189596
(2,3-dichloro-5-nitrophenyl)-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone (PubChem CID 107189596) has the molecular formula C13H14Cl2N2O4 and a molecular weight of 333.17 g/mol. Its IUPAC name is (2,3-dichloro-5-nitrophenyl)-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone.
| Compound Name | (2,3-dichloro-5-nitrophenyl)-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 107189596 |
| Molecular Formula | C13H14Cl2N2O4 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | (2,3-dichloro-5-nitrophenyl)-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2cc([N+](=O)[O-])cc(Cl)c2Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C13H14Cl2N2O4/c1-7-5-16(6-8(2)21-7)13(18)10-3-9(17(19)20)4-11(14)12(10)15/h3-4,7-8H,5-6H2,1-2H3/t7-,8+ |
| InChIKey | MTSNEPVOSYHFFQ-OCAPTIKFSA-N |
| XLogP | 3.15 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|