C16H22O5 — CID 87001615
(2-methoxycyclohexyl) 3,5-dimethoxybenzoate (PubChem CID 87001615) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (2-methoxycyclohexyl) 3,5-dimethoxybenzoate.
| Compound Name | (2-methoxycyclohexyl) 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 87001615 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2-methoxycyclohexyl) 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OC2CCCCC2OC)c1 |
| InChI | InChI=1S/C16H22O5/c1-18-12-8-11(9-13(10-12)19-2)16(17)21-15-7-5-4-6-14(15)20-3/h8-10,14-15H,4-7H2,1-3H3 |
| InChIKey | IAAKENGXBIJLLO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |