C22H25N3O6S — CID 101199094
[(1S,2S,5R)-2-[4-(dimethylamino)phenyl]sulfanyl-5-methylcyclohexyl] 3,5-dinitrobenzoate (PubChem CID 101199094) has the molecular formula C22H25N3O6S and a molecular weight of 459.52 g/mol. Its IUPAC name is [(1S,2S,5R)-2-[4-(dimethylamino)phenyl]sulfanyl-5-methylcyclohexyl] 3,5-dinitrobenzoate.
| Compound Name | [(1S,2S,5R)-2-[4-(dimethylamino)phenyl]sulfanyl-5-methylcyclohexyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 101199094 |
| Molecular Formula | C22H25N3O6S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | [(1S,2S,5R)-2-[4-(dimethylamino)phenyl]sulfanyl-5-methylcyclohexyl] 3,5-dinitrobenzoate |
| SMILES | C[C@@H]1CC[C@H](Sc2ccc(N(C)C)cc2)[C@@H](OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C22H25N3O6S/c1-14-4-9-21(32-19-7-5-16(6-8-19)23(2)3)20(10-14)31-22(26)15-11-17(24(27)28)13-18(12-15)25(29)30/h5-8,11-14,20-21H,4,9-10H2,1-3H3/t14-,20+,21+/m1/s1 |
| InChIKey | OJURFHYNDIKOLH-OREJSRFESA-N |
| XLogP | 5.08 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|