C36H23N9O24 — CID 611290
[6,7,8-tris[(3,5-dinitrobenzoyl)oxy]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] 3,5-dinitrobenzoate (PubChem CID 611290) has the molecular formula C36H23N9O24 and a molecular weight of 965.62 g/mol. Its IUPAC name is [6,7,8-tris[(3,5-dinitrobenzoyl)oxy]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] 3,5-dinitrobenzoate.
| Compound Name | [6,7,8-tris[(3,5-dinitrobenzoyl)oxy]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 611290 |
| Molecular Formula | C36H23N9O24 |
| Molecular Weight | 965.62 g/mol |
| Exact Mass | 965.09 |
| IUPAC Name | [6,7,8-tris[(3,5-dinitrobenzoyl)oxy]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] 3,5-dinitrobenzoate |
| SMILES | O=C(OC1CN2CCC(OC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)C2C(OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C1OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H23N9O24/c46-33(16-3-20(38(50)51)11-21(4-16)39(52)53)66-28-1-2-37-15-29(67-34(47)17-5-22(40(54)55)12-23(6-17)41(56)57)31(68-35(48)18-7-24(42(58)59)13-25(8-18)43(60)61)32(30(28)37)69-36(49)19-9-26(44(62)63)14-27(10-19)45(64)65/h3-14,28-32H,1-2,15H2 |
| InChIKey | ODTIIJWJLBOUAJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 453.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 25 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 25 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|