C14H14N2O11 — CID 25158041
(1S,3R,4R,5R)-3-(3,5-dinitrobenzoyl)oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid (PubChem CID 25158041) has the molecular formula C14H14N2O11 and a molecular weight of 386.27 g/mol. Its IUPAC name is (1S,3R,4R,5R)-3-(3,5-dinitrobenzoyl)oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid.
| Compound Name | (1S,3R,4R,5R)-3-(3,5-dinitrobenzoyl)oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 25158041 |
| Molecular Formula | C14H14N2O11 |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (1S,3R,4R,5R)-3-(3,5-dinitrobenzoyl)oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O[C@@H]1C[C@](O)(C(=O)O)C[C@@H](O)[C@H]1O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H14N2O11/c17-9-4-14(22,13(20)21)5-10(11(9)18)27-12(19)6-1-7(15(23)24)3-8(2-6)16(25)26/h1-3,9-11,17-18,22H,4-5H2,(H,20,21)/t9-,10-,11-,14+/m1/s1 |
| InChIKey | GOBWDYUBPOZGPF-BIAAXOCRSA-N |
| XLogP | -0.64 |
| TPSA | 210.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|