C14H16O7S — CID 10687709
(1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(E)-3-thiophen-3-ylprop-2-enoyl]oxycyclohexane-1-carboxylic acid (PubChem CID 10687709) has the molecular formula C14H16O7S and a molecular weight of 328.34 g/mol. Its IUPAC name is (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(E)-3-thiophen-3-ylprop-2-enoyl]oxycyclohexane-1-carboxylic acid.
| Compound Name | (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(E)-3-thiophen-3-ylprop-2-enoyl]oxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 10687709 |
| Molecular Formula | C14H16O7S |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(E)-3-thiophen-3-ylprop-2-enoyl]oxycyclohexane-1-carboxylic acid |
| SMILES | O=C(/C=C/c1ccsc1)O[C@@H]1C[C@](O)(C(=O)O)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H16O7S/c15-9-5-14(20,13(18)19)6-10(12(9)17)21-11(16)2-1-8-3-4-22-7-8/h1-4,7,9-10,12,15,17,20H,5-6H2,(H,18,19)/b2-1+/t9-,10-,12-,14+/m1/s1 |
| InChIKey | GAEXCAAGXVFGFO-BLGYJXKWSA-N |
| XLogP | 0.00 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|