C21H22N2O8 — CID 134864831
ethyl (6R)-6-(3,5-dinitrobenzoyl)oxytricyclo[5.3.1.03,8]undec-9-ene-2-carboxylate (PubChem CID 134864831) has the molecular formula C21H22N2O8 and a molecular weight of 430.41 g/mol. Its IUPAC name is ethyl (6R)-6-(3,5-dinitrobenzoyl)oxytricyclo[5.3.1.03,8]undec-9-ene-2-carboxylate.
| Compound Name | ethyl (6R)-6-(3,5-dinitrobenzoyl)oxytricyclo[5.3.1.03,8]undec-9-ene-2-carboxylate |
|---|---|
| PubChem CID | 134864831 |
| Molecular Formula | C21H22N2O8 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | ethyl (6R)-6-(3,5-dinitrobenzoyl)oxytricyclo[5.3.1.03,8]undec-9-ene-2-carboxylate |
| SMILES | CCOC(=O)C1C2C=CC3C1CC[C@@H](OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C3C2 |
| InChI | InChI=1S/C21H22N2O8/c1-2-30-21(25)19-11-3-4-15-16(19)5-6-18(17(15)9-11)31-20(24)12-7-13(22(26)27)10-14(8-12)23(28)29/h3-4,7-8,10-11,15-19H,2,5-6,9H2,1H3/t11?,15?,16?,17?,18-,19?/m1/s1 |
| InChIKey | AURVRCHKUXRRNB-JSKJOMAYSA-N |
| XLogP | 3.44 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|