C18H25NO2 — CID 70301627
2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethyl benzoate (PubChem CID 70301627) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethyl benzoate.
| Compound Name | 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethyl benzoate |
|---|---|
| PubChem CID | 70301627 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-(2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl)ethyl benzoate |
| SMILES | CC1(C)C2CC(CCOC(=O)c3ccccc3)C(N)C1C2 |
| InChI | InChI=1S/C18H25NO2/c1-18(2)14-10-13(16(19)15(18)11-14)8-9-21-17(20)12-6-4-3-5-7-12/h3-7,13-16H,8-11,19H2,1-2H3 |
| InChIKey | SKWIWTZPYJPNSJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |