About 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate
2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate (PubChem CID 132838766) has the molecular formula C18H22O2
and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate.
Molecular Properties
| Compound Name | 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate |
| PubChem CID | 132838766 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate |
| SMILES | CC1(C)[C@H]2CC(CCOC(=O)c3ccccc3)=C[C@@H]1C2 |
| InChI | InChI=1S/C18H22O2/c1-18(2)15-10-13(11-16(18)12-15)8-9-20-17(19)14-6-4-3-5-7-14/h3-7,10,15-16H,8-9,11-12H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | KVYFBPIRRWUULG-CVEARBPZSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate?
The IUPAC name of 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate (CID 132838766) is 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate.
What is the SMILES notation for 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate?
The canonical SMILES for 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate is CC1(C)[C@H]2CC(CCOC(=O)c3ccccc3)=C[C@@H]1C2.
What is the InChIKey of 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate?
The InChIKey is KVYFBPIRRWUULG-CVEARBPZSA-N. The full InChI is InChI=1S/C18H22O2/c1-18(2)15-10-13(11-16(18)12-15)8-9-20-17(19)14-6-4-3-5-7-14/h3-7,10,15-16H,8-9,11-12H2,1-2H3/t15-,16+/m1/s1.
What are the key properties of 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate?
2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate has a molecular weight of 270.37 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,5R)-6,6-dimethyl-3-bicyclo[3.1.1]hept-2-enyl]ethyl benzoate is sourced from PubChem (CID 132838766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).