C18H30O3 — CID 155714321
2-(2,2-dimethylcyclopropyl)oxyethyl benzoate;ethane (PubChem CID 155714321) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-(2,2-dimethylcyclopropyl)oxyethyl benzoate;ethane.
| Compound Name | 2-(2,2-dimethylcyclopropyl)oxyethyl benzoate;ethane |
|---|---|
| PubChem CID | 155714321 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2-(2,2-dimethylcyclopropyl)oxyethyl benzoate;ethane |
| SMILES | CC.CC.CC1(C)CC1OCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18O3.2C2H6/c1-14(2)10-12(14)16-8-9-17-13(15)11-6-4-3-5-7-11;2*1-2/h3-7,12H,8-10H2,1-2H3;2*1-2H3 |
| InChIKey | VKIVPOIUBJUTPO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|